| MDL | MFCD05663669 |
|---|---|
| Molecular Weight | 571.62 |
| Molecular Formula | C32H33N3O7 |
| SMILES | O[C@H]1C[C@H](N2C(N=C(NC(C)=O)C=C2)=O)O[C@@H]1COC(C3=CC=C(OC)C=C3)(C4=CC=C(OC)C=C4)C5=CC=CC=C5 |
5'-O-DMT-N4-Ac-dC (N4-Acetyl-2'-deoxy-5'-O-DMT-cytidine, compound 7), a deoxynucleoside, can be used to synthesize of dodecyl phosphoramidite which is the raw material for dod‐DNA (amphiphilic DNA containing an internal hydrophobic region consisting of dodecyl phosphotriester linkages) synthesis [1] [2] .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 174.94 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 1.7494 mL | 8.7471 mL | 17.4941 mL |
| 5 mM | 0.3499 mL | 1.7494 mL | 3.4988 mL |
| 10 mM | 0.1749 mL | 0.8747 mL | 1.7494 mL |