| MDL | MFCD29049488 |
|---|---|
| Molecular Weight | 732.64 |
| Molecular Formula | C37H32O16 |
| SMILES | OC1=C(O)C=CC(C[C@H](C(OC)=O)OC([C@H]2C3=C(/C=C/C(O[C@@H](C(O)=O)CC4=CC(O)=C(O)C=C4)=O)C=CC(O)=C3O[C@@H]2C5=CC(O)=C(O)C=C5)=O)=C1 |
9''-Methyl salvianolate B is a phenolic compound isolated from Radix Salvia miltiorrhizae [1] .
Solid
Room temperature in continental US; may vary elsewhere.
4°C, sealed storage, away from moisture and light
* In solvent : -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light)