| MDL | MFCD09998721 |
|---|---|
| Molecular Weight | 236.74 |
| Molecular Formula | C10H21CLN2O2 |
| Boiling Point | - |
| SMILES | CN(CC1CNC1)C(=O)OC(C)(C)C.Cl |
| GHS Pictogram: | ![]() |
|---|---|
| Signal Word: | Warning |
| Hazard Statements: | May be harmful in contact with skinMay be harmful if swallowedMay be harmful if inhaled |
| Precautionary Statements: | Do not breathe dust/fume/gas/mist/vapours/spray. Wash hands thoroughly after handling.Do not eat, drink or smoke when using this product.Use only outdoors or in a well-ventilated area.Wear protective gloves/protective clothing/eye protection/face protection. |
| UN #: | - |
| Class: | - |
| Packing Group: | - |