| MDL | MFCD00020373 |
|---|---|
| Molecular Weight | 257.31 |
| Molecular Formula | C11H15NO4S |
| SMILES | O=C(O)C1=CC=C(S(=O)(N(CC)CC)=O)C=C1 |
Etebenecid is a uricosuric agents, lower uric acid levels in the body by increasing the elimination of uric acid by the kidneys, also inhibits penicillin tubular secretion.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 250 mg/mL ( 971.59 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 3.8864 mL | 19.4318 mL | 38.8636 mL |
| 5 mM | 0.7773 mL | 3.8864 mL | 7.7727 mL |
| 10 mM | 0.3886 mL | 1.9432 mL | 3.8864 mL |