| MDL | MFCD18642659 |
|---|---|
| Molecular Weight | 459.54 |
| Molecular Formula | C25H29N7O2 |
| SMILES | O=C1C2=C(C=CC=C2)N(C)C3=NC(NC4=C(OC)C=C(N5CCN(C)CC5)C=C4)=NC=C3N1C |
|
ERK5 87 nM (IC 50 ) |
LRRK2[G2019S] 26 nM (IC 50 ) |
ERK5-IN-1 (Compound 5) exhibits a cellular EC 50 for inhibiting epidermal growth factor (EGF) induced ERK5 autophosphorylation of 0.19±0.04 μM [1] .
MCE has not independently confirmed the accuracy of these methods. They are for reference only.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : ≥ 100 mg/mL ( 217.61 mM )
* "≥" means soluble, but saturation unknown.
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.1761 mL | 10.8804 mL | 21.7609 mL |
| 5 mM | 0.4352 mL | 2.1761 mL | 4.3522 mL |
| 10 mM | 0.2176 mL | 1.0880 mL | 2.1761 mL |