| MDL | - |
|---|---|
| Molecular Weight | 583.08 |
| Molecular Formula | C32H31ClN6O3 |
| SMILES | O=C(NC1=C(OCC)C=C2N=CC(C#N)=C(NC3=CC=C(OCC4=NC=CC=C4)C(Cl)=C3)C2=C1)/C=C/C5N(C)CCC5 |
(Rac)-Pyrotinib ((Rac)-SHR-1258) is the racemate of Pyrotinib (HY-104065). Pyrotinib is a potent and selective EGFR/HER2 dual inhibitor.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 1.81 mg/mL ( 3.10 mM ; Need ultrasonic and warming)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 1.7150 mL | 8.5752 mL | 17.1503 mL |
| 5 mM | --- | --- | --- |
| 10 mM | --- | --- | --- |