| MDL | MFCD09833264 |
|---|---|
| Molecular Weight | 442.51 |
| Molecular Formula | C26H26N4O3 |
| SMILES | O=C(C1=CC2=CC(N3CCN(CCCCC4=CNC5=C4C=C(C#N)C=C5)CC3)=CC=C2O1)O |
Vilazodone carboxylic acid is a vilazodone metabolite observed in both urine (major) and plasma (minor) [1] .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 4 mg/mL ( 9.04 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.2598 mL | 11.2992 mL | 22.5984 mL |
| 5 mM | 0.4520 mL | 2.2598 mL | 4.5197 mL |
| 10 mM | --- | --- | --- |