| MDL | MFCD00376120 |
|---|---|
| Molecular Weight | 338.44 |
| Molecular Formula | C21H26N2O2 |
| SMILES | O=C(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)NCCCCCCN |
Fmoc-1,6-diaminohexane is an analog of Osw-1 which has the potential for Alzheimer's disease and cancer treatment from patent US 20140135279 A1.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 150 mg/mL ( 443.21 mM ; Need ultrasonic and warming)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.9547 mL | 14.7737 mL | 29.5473 mL |
| 5 mM | 0.5909 mL | 2.9547 mL | 5.9095 mL |
| 10 mM | 0.2955 mL | 1.4774 mL | 2.9547 mL |