| MDL | MFCD31619312 |
|---|---|
| Molecular Weight | 430.84 |
| Molecular Formula | C21H17ClF2N4O2 |
| SMILES | O=C(C=C)N1CCN(C2=NC=NC3=C2C=C(Cl)C(C4=C(O)C=CC=C4F)=C3F)CC1 |
ARS-1323, the racemate of ARS-1620, is a novel inhibitor of mutant K-ras G12C extracted from patent WO 2015054572 A1.
|
KRas G12C |
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 232.10 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.3210 mL | 11.6052 mL | 23.2105 mL |
| 5 mM | 0.4642 mL | 2.3210 mL | 4.6421 mL |
| 10 mM | 0.2321 mL | 1.1605 mL | 2.3210 mL |