| MDL | MFCD00004793 |
|---|---|
| Molecular Weight | 232.32 |
| Molecular Formula | C18H16 |
| SMILES | C1(/C=C/C=C/C=C/C2=CC=CC=C2)=CC=CC=C1 |
1,6-Diphenylhexa-1,3,5-triene is a fluorescent probe [1] .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 14.29 mg/mL ( 61.51 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 4.3044 mL | 21.5220 mL | 43.0441 mL |
| 5 mM | 0.8609 mL | 4.3044 mL | 8.6088 mL |
| 10 mM | 0.4304 mL | 2.1522 mL | 4.3044 mL |