| MDL | MFCD00210494 |
|---|---|
| Molecular Weight | 256.25 |
| Molecular Formula | C15H12O4 |
| SMILES | O=C1C(C2=CC=C(O)C=C2)COC3=CC(O)=CC=C13 |
Dihydrodaidzein is one of the most prominent dietary phytoestrogens.
|
Human Endogenous Metabolite |
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 390.24 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 3.9024 mL | 19.5122 mL | 39.0244 mL |
| 5 mM | 0.7805 mL | 3.9024 mL | 7.8049 mL |
| 10 mM | 0.3902 mL | 1.9512 mL | 3.9024 mL |