| MDL | MFCD00001236 |
|---|---|
| Molecular Weight | 238.24 |
| Molecular Formula | C15H10O3 |
| SMILES | O=C1C2=C(C=CC=C2)C(C3=CC=C(CO)C=C13)=O |
2-(Hydroxymethyl)anthraquinone is used as a photoremovable protecting group ( PRPG ) to chemically cage sex pheromone (e.g. (Z)-11-hexadecen-1-ol (sex pheromone of Chilo infuscatellussnellen )) [1] .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 419.74 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 4.1974 mL | 20.9872 mL | 41.9745 mL |
| 5 mM | 0.8395 mL | 4.1974 mL | 8.3949 mL |
| 10 mM | 0.4197 mL | 2.0987 mL | 4.1974 mL |