| MDL | MFCD00953614 |
|---|---|
| Molecular Weight | 273.26 |
| Molecular Formula | C14H12FN3O2 |
| SMILES | FC1=CC=C(OC2=CC=C(/C=N/NC(N)=O)C=C2)C=C1 |
Co 102862 (V 102862) is a potent, broad-spectrum, state-dependent Na + channel blocker. Co 102862 is also an orally active anticonvulsant [1] .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 41.67 mg/mL ( 152.49 mM ; ultrasonic and warming and heat to 80°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 3.6595 mL | 18.2976 mL | 36.5952 mL |
| 5 mM | 0.7319 mL | 3.6595 mL | 7.3190 mL |
| 10 mM | 0.3660 mL | 1.8298 mL | 3.6595 mL |