| MDL | MFCD28506265 |
|---|---|
| Molecular Weight | 359.44 |
| Molecular Formula | C16H25NO6S |
| SMILES | O=C(OC(C)(C)C)NCCOCCOS(=O)(C1=CC=C(C)C=C1)=O |
|
PEGs |
Alkyl/ether |
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins [1] .
MCE has not independently confirmed the accuracy of these methods. They are for reference only.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 250 mg/mL ( 695.53 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.7821 mL | 13.9105 mL | 27.8211 mL |
| 5 mM | 0.5564 mL | 2.7821 mL | 5.5642 mL |
| 10 mM | 0.2782 mL | 1.3911 mL | 2.7821 mL |