| MDL | - |
|---|---|
| Molecular Weight | 443.85 |
| Molecular Formula | C19H21ClF3N5O2 |
| SMILES | O=C1C=C(N2[C@H](C)COCC2)N=C3N1CC[C@H](C(F)(F)F)N3CC4=CC(Cl)=CN=C4 |
SAR405 R enantiomer is the less active enantiomer of SAR405. SAR405 is a PIK3C3/Vps34 inhibitor.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 225.30 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.2530 mL | 11.2651 mL | 22.5301 mL |
| 5 mM | 0.4506 mL | 2.2530 mL | 4.5060 mL |
| 10 mM | 0.2253 mL | 1.1265 mL | 2.2530 mL |