| MDL | MFCD31728145 |
|---|---|
| Molecular Weight | 575.72 |
| Molecular Formula | C28H41N5O6S |
| SMILES | O=C([C@H]1N(C([C@@H](NC(COCCOCCN)=O)C(C)(C)C)=O)C[C@H](O)C1)NCC2=CC=C(C3=C(C)N=CS3)C=C2 |
|
VHL |
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins [1] .
MCE has not independently confirmed the accuracy of these methods. They are for reference only.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |