| MDL | - |
|---|---|
| Molecular Weight | 330.25 |
| Molecular Formula | C16H10O8 |
| SMILES | O=C1C2=CC(O)=C(OC)C(O3)=C2C4=C(C3=O)C=C(O)C(OC)=C4O1 |
3,3'-Di-O-methylellagic acid obtained from Euphorbia adenochlora selectively inhibits the formation of acid-fastness in mycobacteria without retardation of their growth. 3,3'-di-O-methylellagic acid as a hepatoprotective compound is apparently due to its antioxidative effect [1] [2] .
Solid
Room temperature in continental US; may vary elsewhere.
4°C, protect from light
* In solvent : -80°C, 6 months; -20°C, 1 month (protect from light)