| MDL | MFCD16872050 |
|---|---|
| Molecular Weight | 496.42 |
| Molecular Formula | C25H18F2N2O7 |
| SMILES | O=C1OC2(C3=C(OC4=C2C=C(F)C(OC(C)=O)=C4)C=C(OC(C)=O)C(F)=C3)C5=C1C(N)=C(NC)C=C5 |
DAF-FM DA is a reagent to detect and quantify low concentrations of nitric oxide (NO); DAF-FM fluorescence can be detected by any instrument that can detect fluorescein, including flow cytometers, microscopes, fluorescent microplate readers and fluorometers.
Solid
Room temperature in continental US; may vary elsewhere.
-20°C, protect from light
* In solvent : -80°C, 6 months; -20°C, 1 month (protect from light)