| MDL | MFCD00869007 |
|---|---|
| Molecular Weight | 333.42 |
| Molecular Formula | C19H27NO4 |
| SMILES | O=C(N1CCCCCCC1)/C=C/C2=CC(OC)=C(OC)C(OC)=C2 |
Cinoctramide is an intermediate of pharmaceutical synthesis. Cinoctramide can be used for the research of autoimmune diseases [1] .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 125 mg/mL ( 374.90 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.9992 mL | 14.9961 mL | 29.9922 mL |
| 5 mM | 0.5998 mL | 2.9992 mL | 5.9984 mL |
| 10 mM | 0.2999 mL | 1.4996 mL | 2.9992 mL |