| MDL | - |
|---|---|
| Molecular Weight | 594.56 |
| Molecular Formula | C34H26O10 |
| SMILES | O=C1C=C(C2=CC=C(OC)C=C2)OC3=C(C4=CC(C5=CC(C6=C(O)C=C(OC)C=C6O5)=O)=CC=C4OC)C(OC)=CC(O)=C13 |
Amentoflavone 7,4',7'',4'''-tetramethyl ether, a biflavone, is a natural product that can be isolated from Selaginella moellendorffii [1] .
Solid
Room temperature in continental US; may vary elsewhere.
4°C, protect from light
* In solvent : -80°C, 6 months; -20°C, 1 month (protect from light)
DMSO : 1 mg/mL ( 1.68 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 1.6819 mL | 8.4096 mL | 16.8192 mL |
| 5 mM | --- | --- | --- |
| 10 mM | --- | --- | --- |