| MDL | MFCD00007386 |
|---|---|
| Molecular Weight | 230.06 |
| Molecular Formula | - |
| Boiling Point | - |
| SMILES | c1cc(ccc1CCBr)[N+](=O)[O-] |
| GHS Pictogram: | ![]() |
|---|---|
| Signal Word: | Irritant |
| Hazard Statements: | Toxic to aquatic life with long lasting effects.|May cause respiratory irritation.|Harmful if swallowed.|Causes skin irritation.|Causes serious eye irritation.|May cause an allergic skin reaction.|Suspected of causing cancer. |
| Precautionary Statements: | Obtain special instructions before use.|Use only outdoors or in a well-ventilated area.|Wear protective gloves: hazard.Obtain special instructions before use.|Use only outdoors or in a well-ventilated area.|Wear protective gloves protective clothing: hazard. protective clothing eye protection and face protection.|Avoid breathing dust/fumes.|Wash all exposed external body areas thoroughly after hand: hazard. eye protection and face protection.|Avoid breathing dust/fumes.|Wash all exposed external body areas thoroughly after hand |
| UN #: | - |
| Class: | - |
| Packing Group: | - |