| MDL | MFCD28964207 |
|---|---|
| Molecular Weight | 462.36 |
| Molecular Formula | C21H18O12 |
| SMILES | O=C1C2=C(O)C=C(O)C=C2OC(C3=CC(O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)C(O)=O)=C(O)C=C3)=C1 |
Luteolin-3-O-beta-D-glucuronide is a luteolin glucosiduronic acid consisting of luteolin having a beta-D-glucosiduronic acid residue attached at the 3'-position.
Solid
Room temperature in continental US; may vary elsewhere.
4°C, protect from light
* In solvent : -80°C, 6 months; -20°C, 1 month (protect from light)
DMSO : 100 mg/mL ( 216.28 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.1628 mL | 10.8141 mL | 21.6282 mL |
| 5 mM | 0.4326 mL | 2.1628 mL | 4.3256 mL |
| 10 mM | 0.2163 mL | 1.0814 mL | 2.1628 mL |