| MDL | MFCD00004351 |
|---|---|
| Molecular Weight | 212.24 |
| Molecular Formula | - |
| Boiling Point | - |
| SMILES | c1ccc(cc1)c2ccc(cc2)CC(=O)O |
| GHS Pictogram: | ![]() |
|---|---|
| Signal Word: | Toxic/Irritant |
| Hazard Statements: | Very toxic to aquatic life.|Toxic if inhaled.|May cause respiratory irritation.|Causes skin irritation.|Causes serious eye irritation.|Toxic if swallowed. |
| Precautionary Statements: | Wash all exposed external body areas thoroughly after handling.|Do not eat: hazard.Wash all exposed external body areas thoroughly after handling.|Do not eat drink or smoke when using this product.|Use only outdoors or in a well-ventilated area.|Avoid breathing dust/fumes.|Avoid release to the environment.|Wear protective gloves: hazard. drink or smoke when using this product.|Use only outdoors or in a well-ventilated area.|Avoid breathing dust/fumes.|Avoid release to the environment.|Wear protective gloves prote: hazard. prote |
| UN #: | - |
| Class: | - |
| Packing Group: | - |