| MDL | MFCD00007104 |
|---|---|
| Molecular Weight | 228.12 |
| Molecular Formula | - |
| Boiling Point | - |
| SMILES | c1c(cc(c(c1C(=O)O)O)[N+](=O)[O-])[N+](=O)[O-] |
| GHS Pictogram: | ![]() |
|---|---|
| Signal Word: | Harmful/Irritant |
| Hazard Statements: | Harmful in contact with skin.|May cause damage to organs through prolonged or repeated exposure.|Harmful if inhaled.|May cause respiratory irritation.|Harmful if swallowed.|Causes skin irritation.|Causes serious eye irritation.|May cause an allergic skin |
| Precautionary Statements: | Do not breathe dust/fume.|Use only outdoors or in a well-ventilated area.|Wear protective gloves: hazard.Do not breathe dust/fume.|Use only outdoors or in a well-ventilated area.|Wear protective gloves protective clothing: hazard. protective clothing eye protection and face protection.|Wash all exposed external body areas thoroughly after handling.|Do not eat: hazard. eye protection and face protection.|Wash all exposed external body areas thoroughly after handling.|Do not eat drink or smoke when usin: hazard. drink or smoke when usin |
| UN #: | - |
| Class: | - |
| Packing Group: | - |