| MDL | MFCD00132932 |
|---|---|
| Molecular Weight | 194.18 |
| Molecular Formula | C10H10O4 |
| SMILES | O=C(OC)/C=C/C1=CC(O)=CC=C1O |
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 125 mg/mL ( 643.73 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 5.1499 mL | 25.7493 mL | 51.4986 mL |
| 5 mM | 1.0300 mL | 5.1499 mL | 10.2997 mL |
| 10 mM | 0.5150 mL | 2.5749 mL | 5.1499 mL |