| MDL | MFCD00017705 |
|---|---|
| Molecular Weight | 240.25 |
| Molecular Formula | C15H12O3 |
| SMILES | O=C1CC(C2=CC=C(O)C=C2)OC3=CC=CC=C13 |
4'-Hydroxyflavanone is an inhibitor of SREBP maturation and lipid synthesis. 4'-Hydroxyflavanone is a synthetic analogue of flavanone, has potential for hepatic steatosis and dyslipidemia research [1] .
Solid
Aspergillus niger
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 416.23 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 4.1623 mL | 20.8117 mL | 41.6233 mL |
| 5 mM | 0.8325 mL | 4.1623 mL | 8.3247 mL |
| 10 mM | 0.4162 mL | 2.0812 mL | 4.1623 mL |