| MDL | - |
|---|---|
| Molecular Weight | 408.45 |
| Molecular Formula | C22H24N4O4 |
| SMILES | O=C1N2C(C(C(C)NC3=CC=CC=C3C(O)=O)=CC(C)=C2)=NC(N4CCOCC4)=C1 |
(Rac)-AZD 6482 ((Rac)-KIN-193) is the racemate of AZD 6482. AZD 6482 is a potent and selective p110β inhibitor with an IC 50 of 0.69 nM.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |