| MDL | MFCD00465636 |
|---|---|
| Molecular Weight | 196.05 |
| Molecular Formula | - |
| Boiling Point | - |
| SMILES | C(C(C(C(=O)O)(F)F)(F)F)(F)F |
| GHS Pictogram: | ![]() |
|---|---|
| Signal Word: | Corrosive |
| Hazard Statements: | H314: Causes severe skin burns and eye damage. |
| Precautionary Statements: | P301+P330+P331: IF SWALLOWED: Rinse mouth. Do NOT induce vomiting
P303+P361+P353: IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water {{{0|||message= |
| UN #: | - |
| Class: | - |
| Packing Group: | - |