| MDL | MFCD09045976 |
|---|---|
| Molecular Weight | 243.08 |
| Molecular Formula | - |
| Boiling Point | - |
| SMILES | O=S(CC1=C(F)C=CC=C1Cl)(Cl)=O |
| GHS Pictogram: | ![]() ![]() |
|---|---|
| Signal Word: | Corrosive |
| Hazard Statements: | ['/resources/a-image/GHS/GHS05.png', '/resources/a-image/GHS/GHS07.png'] |
| Precautionary Statements: | H314: Causes severe skin burns and eye damage. EUH014: Reacts violently with water. EUH029: Contact with water liberates toxic gas. H302+332: Harmful if swallowed or if inhaled. |
| UN #: | - |
| Class: | - |
| Packing Group: | - |