| MDL | MFCD03425545 |
|---|---|
| Molecular Weight | 244.25 |
| Molecular Formula | C8H16N6O3 |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCN=[N+]=[N-] |
|
PEGs |
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins [1] .
MCE has not independently confirmed the accuracy of these methods. They are for reference only.
Liquid
Room temperature in continental US; may vary elsewhere.
| Pure form | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 409.42 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 4.0942 mL | 20.4708 mL | 40.9417 mL |
| 5 mM | 0.8188 mL | 4.0942 mL | 8.1883 mL |
| 10 mM | 0.4094 mL | 2.0471 mL | 4.0942 mL |