| MDL | - |
|---|---|
| Molecular Weight | 408.45 |
| Molecular Formula | C19H10D9F2N7O |
| SMILES | CN1N=CN=C1COC(C(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])=C2)=NN3C2=NN=C3C4=CC(F)=CC=C4F |
L-838417-d 9 is the deuterium labeled L-838417. L-838417 is a subtype-selective GABAA positive allosteric modulator, acting as a partial agonist at α2, α3 and α5 subtypes[1].
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 12.5 mg/mL ( 30.60 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.4483 mL | 12.2413 mL | 24.4826 mL |
| 5 mM | 0.4897 mL | 2.4483 mL | 4.8965 mL |
| 10 mM | 0.2448 mL | 1.2241 mL | 2.4483 mL |