| MDL | - |
|---|---|
| Molecular Weight | 555.41 |
| Molecular Formula | C26H24Cl2N6O4 |
| SMILES | O=C1N(C2=CC(Cl)=CN(C)C2=O)[C@H](C3=CC=C(Cl)C=C3)C4=C1N=C(C5=CN=C(OC)N=C5OC)N4C(C)C |
Siremadlin R Enantiomer (NVP-HDM201 R Enantiomer) is the R enantiomer of Siremadlin. Siremadlin is a potent and highly specific MDM-2/p53 inhibitor.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : ≥ 56.75 mg/mL ( 102.18 mM )
* "≥" means soluble, but saturation unknown.
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 1.8005 mL | 9.0024 mL | 18.0047 mL |
| 5 mM | 0.3601 mL | 1.8005 mL | 3.6009 mL |
| 10 mM | 0.1800 mL | 0.9002 mL | 1.8005 mL |