| MDL | - |
|---|---|
| Molecular Weight | 394.47 |
| Molecular Formula | C25H22N4O |
| SMILES | CC1=C(C2=CC(C3=C4C=CC=NC4=CC=C3C)=C5NC(C6CC6)=NC5=C2)C(C)=NO1 |
|
BRD2 0.59-2.5 nM (Kd) |
BRD3 0.65-0.66 nM (Kd) |
BRD4 1.3-3.2 nM (Kd) |
BD1 83 nM (IC 50 ) |
BD2 78 nM (IC 50 ) |
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 25 mg/mL ( 63.38 mM ; ultrasonic and warming and adjust pH to 4 with HCl and heat to 80°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.5350 mL | 12.6752 mL | 25.3505 mL |
| 5 mM | 0.5070 mL | 2.5350 mL | 5.0701 mL |
| 10 mM | 0.2535 mL | 1.2675 mL | 2.5350 mL |