| MDL | - |
|---|---|
| Molecular Weight | 372.45 |
| Molecular Formula | C22H28O5 |
| SMILES | C[C@@]12[C@](C(CO)=O)(O)[C@H](C)C[C@@]1([H])[C@]3([H])CCC4=CC(C=C[C@]4(C)[C@]3(O5)[C@]5([H])C2)=O |
Dexamethasone 9,11-epoxide, a compound extracted from patent CN 106520896 A and RU 2532902 C1, is an intermediate in the preparation of dexamethasone.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 268.49 mM ; Need ultrasonic)
H 2 O : < 0.1 mg/mL (insoluble)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.6849 mL | 13.4246 mL | 26.8492 mL |
| 5 mM | 0.5370 mL | 2.6849 mL | 5.3698 mL |
| 10 mM | 0.2685 mL | 1.3425 mL | 2.6849 mL |