| MDL | - |
|---|---|
| Molecular Weight | 287.40 |
| Molecular Formula | C15H29NO4 |
| SMILES | CCCCCCCC(O[C@H](CC([O-])=O)C[N+](C)(C)C)=O |
L-Octanoylcarnitine is the physiologically active form of octanoylcarnitine.
|
Human Endogenous Metabolite |
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 5 mg/mL ( 17.40 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 3.4795 mL | 17.3974 mL | 34.7947 mL |
| 5 mM | 0.6959 mL | 3.4795 mL | 6.9589 mL |
| 10 mM | 0.3479 mL | 1.7397 mL | 3.4795 mL |