| MDL | - |
|---|---|
| Molecular Weight | 472.29 |
| Molecular Formula | C24H16Cl2FNO4 |
| SMILES | O=C1C2=CC=C3OCN(CC3=C2OC(C4=CC(Cl)=C(C=C4)Cl)=C1O)CC5=CC(F)=CC=C5 |
DEPTOR-IN-1 is a novel putative DEPTOR inhibitor with a K d value of 9.3 μM.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 4 mg/mL ( 8.47 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.1173 mL | 10.5867 mL | 21.1734 mL |
| 5 mM | 0.4235 mL | 2.1173 mL | 4.2347 mL |
| 10 mM | --- | --- | --- |
Add each solvent one by one: 10% DMSO >> 90% corn oil
Solubility: ≥ 0.4 mg/mL (0.85 mM); Clear solution