| MDL | - |
|---|---|
| Molecular Weight | 589.67 |
| Molecular Formula | C31H43NO10 |
| SMILES | CO[C@@H]1C2([C@@](C[C@@]3(O)[C@@H]4OC(C5=CC=CC=C5)=O)([H])[C@@]4([H])[C@](O)([C@@H](O)[C@@H]3OC)C6C2N(C)C7)[C@@]([C@H]6OC)([H])[C@@]7(COC)[C@H](O)C1 |
Benzoylmesaconine is the most abundant component of Wutou decoction, which is widely used in China because of its therapeutic effect on rheumatoid arthritis.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 169.59 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 1.6959 mL | 8.4793 mL | 16.9586 mL |
| 5 mM | 0.3392 mL | 1.6959 mL | 3.3917 mL |
| 10 mM | 0.1696 mL | 0.8479 mL | 1.6959 mL |