| MDL | - |
|---|---|
| Molecular Weight | 459.48 |
| Molecular Formula | C16H25N7O7S |
| SMILES | O[C@@H]1[C@@H](COS(NC([C@H](N)CC(C)C)=O)(=O)=O)O[C@@H](N2C(N=CN=C3N)=C3N=C2)[C@@H]1O |
Leu-AMS R enantiomer is the R enatiomer of Leu-AMS. Leu-AMS is a potent inhibitor of leucyl-tRNA synthetase (LRS) and inhibits the growth of bacteria.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 50.5 mg/mL ( 109.91 mM ; Need ultrasonic and warming)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.1764 mL | 10.8819 mL | 21.7637 mL |
| 5 mM | 0.4353 mL | 2.1764 mL | 4.3527 mL |
| 10 mM | 0.2176 mL | 1.0882 mL | 2.1764 mL |