| MDL | - |
|---|---|
| Molecular Weight | 1186.97 |
| Molecular Formula | C46H56N14O20P2 |
| SMILES | O=P(O)(OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=C(NC3=O)N)O)O4)O[C@H]5[C@H]([C@@H](O[C@@H]5COP4(O)=O)N6C=NC7=C6N=CN=C7NC(OCC8=CC=C(NC([C@@H](NC([C@H](C(C)C)NC(CCCCCN9C(C=CC9=O)=O)=O)=O)C)=O)C=C8)=O)O |
Mal-Val-Ala-PABA-cGAMP is a ADC linker that can be connected to a STING agonist . Mal-Val-Ala-PABA-cGAMP can be used for the synthesis of antibody-drug conjugates (ADCs) [1] .
|
Cleavable |
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| In solvent | -80°C | 6 months |
| -20°C | 1 month |