| MDL | - |
|---|---|
| Molecular Weight | 415.67 |
| Molecular Formula | C28H41D3O2 |
| SMILES | O[C@@H](C[C@H](O)C1)C(/C1=C([2H])\C=C2[C@@]3([H])[C@@](CCC\2)(C)[C@@H]([C@H](C)/C=C/[C@H](C)C(C)C)CC3)=C([2H])\[2H] |
Doxercalciferol-D3 is the deuterated form of Doxercalciferol, which is a Vitamin D2 analog that acts as a vitamin D receptor activator (VDRA).
Solid
Room temperature in continental US; may vary elsewhere.
-20°C, protect from light, stored under nitrogen
* The compound is unstable in solutions, freshly prepared is recommended.