| MDL | - |
|---|---|
| Molecular Weight | 273.14 |
| Molecular Formula | C513C5H6N4O5 |
| SMILES | O[13C@@]1[13C@](O)[13C@@]([13C]O)O[13C@]1N2C=NC3=C2N=CNC3=O |
[1',2',3',4',5'- 13 C 5 ]Inosine is the 13 C 5 labeled Inosine (HY-N0092)[1].
Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs [1] .
MCE has not independently confirmed the accuracy of these methods. They are for reference only.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |