| MDL | - |
|---|---|
| Molecular Weight | 381.30 |
| Molecular Formula | C18H12F5N3O |
| SMILES | O=C(C1=CN(C)N=C1C(F)F)NC2=CC=CC=C2C3=CC(F)=C(F)C(F)=C3 |
Fluxapyroxad is a synthetic broad-spectrum fungicide for the control of fungal diseases. It works by inhibiting succinate dehydrogenase in complex II of the mitochondrial respiratory chain, resulting in inhibition of spore germination, germ tubes and mycelia growth within the fungus target species [1] .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : ≥ 100 mg/mL ( 262.26 mM )
* "≥" means soluble, but saturation unknown.
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.6226 mL | 13.1130 mL | 26.2261 mL |
| 5 mM | 0.5245 mL | 2.6226 mL | 5.2452 mL |
| 10 mM | 0.2623 mL | 1.3113 mL | 2.6226 mL |