MDL | MFCD22056319 |
---|---|
Molecular Weight | 397.89 |
Molecular Formula | C17H32ClNO7 |
SMILES | O=C(OC(C)(C)C)CCOCCOCCOCCOCCNC(CCl)=O |
PEGs |
Alkyl/ether |
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
MCE has not independently confirmed the accuracy of these methods. They are for reference only.
Liquid
Room temperature in continental US; may vary elsewhere.
Pure form | -20°C | 3 years |
---|---|---|
4°C | 2 years | |
In solvent | -80°C | 6 months |
-20°C | 1 month |