MDL | MFCD06411607 |
---|---|
Molecular Weight | 333.30 |
Molecular Formula | C15H15N3O6 |
SMILES | O=C(N(C=CC1=O)C[C@H](N)C(O)=O)N1CC2=C(C=CC=C2)C(O)=O |
UBP 302 is a potent and selective GLUK5-subunit containing kainate receptor antagonist (apparent K d =402 nM), and displays very little affinity on GluK2 (GluR6) kainate receptors. Anxiolytic effects [1] [2] [3] .
Solid
Room temperature in continental US; may vary elsewhere.
Powder | -20°C | 3 years |
---|---|---|
4°C | 2 years | |
In solvent | -80°C | 6 months |
-20°C | 1 month |